(6Z)-2,4-ditert-butyl-6-[(2-nitrophenyl)hydrazinylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | (6Z)-2,4-ditert-butyl-6-[(2-nitrophenyl)hydrazinylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 52184-14-2 | Molecular Weight | 355.43100 | |
| Density | 1.12 g/cm3 | Boiling Point | 482.8ºC at 760 mmHg | |
| Molecular Formula | C20H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (6Z)-2,4-ditert-butyl-6-[(2-nitrophenyl)hydrazinylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12 g/cm3 |
|---|---|
| Boiling Point | 482.8ºC at 760 mmHg |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.43100 |
| Exact Mass | 355.19000 |
| PSA | 90.77000 |
| LogP | 6.83400 |
| Index of Refraction | 1.562 |
| InChIKey | BBUYLEHVHUQHME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(N=Nc2ccccc2[N+](=O)[O-])c(O)c(C(C)(C)C)c1 |
| HS Code | 2927000090 |
|---|
|
~%
(6Z)-2,4-ditert... CAS#:52184-14-2 |
| Literature: Rosevear, Judi; Wilshire, John F. K. Australian Journal of Chemistry, 1982 , vol. 35, # 10 p. 2089 - 2093 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 257-715-8 |
| 2,4-bis(1,1-dimethylethyl)-6-[(2-nitrophenyl)diazenyl]phenol |
| 2,4-di-t-butylphenol-6(2'-nitrophenylazo)phenol |
| 2,4-bis(1,1-dimethylethyl)-6-(2-nitrophenylazo)phenol |
| 2,4-bis(tert-butyl)-6-[(2-nitrophenyl)azo]phenol |
| 2,4-di-t-butyl-6-(2'-nitrophenylazo)phenol |