2-(2H-Benzo[d][1,2,3]triazol-2-yl)-4,6-di-tert-butylphenol structure
|
Common Name | 2-(2H-Benzo[d][1,2,3]triazol-2-yl)-4,6-di-tert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 3846-71-7 | Molecular Weight | 323.432 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 444.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H25N3O | Melting Point | 152-154°C | |
| MSDS | N/A | Flash Point | 222.3±31.5 °C | |
| Name | 2-(2'-Hydroxy-3',5'-di-tert-butylphenyl)benzotriazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.0±55.0 °C at 760 mmHg |
| Melting Point | 152-154°C |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.432 |
| Flash Point | 222.3±31.5 °C |
| Exact Mass | 323.199768 |
| PSA | 50.94000 |
| LogP | 7.22 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | LHPPDQUVECZQSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)C)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R48/22;R52/53 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 3077 |
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Phenol, 2-(2H-benzotriazol-2-yl)-4,6-bis(1,1-dimethylethyl)- |
| MFCD00142738 |
| 2-(2H-Benzotriazol-2-yl)-4,6-di-tert-butylphenol |
| 2-(2H-Benzo[d][1,2,3]triazol-2-yl)-4,6-di-tert-butylphenol |
| 2-benzotriazol-2-yl-4,6-di-tert-butyl-phenol |
| Phenol, 2-(2H-1,2,3-benzotriazol-2-yl)-4,6-bis(1,1-dimethylethyl)- |
| 2-(benzotriazol-2-yl)-4,6-ditert-butylphenol |
| 2-(2H-Benzotriazol-2-yl)-4,6-bis(2-methyl-2-propanyl)phenol |
| EINECS 223-346-6 |