N-(4-chlorophenyl)-1-(4-hexoxyphenyl)methanimine structure
|
Common Name | N-(4-chlorophenyl)-1-(4-hexoxyphenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 5219-48-7 | Molecular Weight | 315.83700 | |
| Density | 1.04g/cm3 | Boiling Point | 441.7ºC at 760 mmHg | |
| Molecular Formula | C19H22ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | N-(4-chlorophenyl)-1-(4-hexoxyphenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 441.7ºC at 760 mmHg |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.83700 |
| Flash Point | 220.9ºC |
| Exact Mass | 315.13900 |
| PSA | 21.59000 |
| LogP | 6.04970 |
| Index of Refraction | 1.535 |
| InChIKey | ZUJZHURHZZZPOC-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(C=Nc2ccc(Cl)cc2)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-n-Hexyloxybenzylideneamino-p'-chlorobenzene |
| 4-chloro-N-{(E)-[4-(hexyloxy)phenyl]methylidene}aniline |