2-bromo-1-(3,4,5-trimethoxyphenyl)propan-1-one structure
|
Common Name | 2-bromo-1-(3,4,5-trimethoxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 52190-29-1 | Molecular Weight | 303.14900 | |
| Density | 1.359g/cm3 | Boiling Point | 358.5ºC at 760 mmHg | |
| Molecular Formula | C12H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.6ºC | |
| Name | 2-bromo-1-(3,4,5-trimethoxyphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 358.5ºC at 760 mmHg |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.14900 |
| Flash Point | 170.6ºC |
| Exact Mass | 302.01500 |
| PSA | 44.76000 |
| LogP | 2.67850 |
| Index of Refraction | 1.527 |
| InChIKey | UBCRYYSRRCGWIJ-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)C(C)Br)cc(OC)c1OC |
|
~68%
2-bromo-1-(3,4,... CAS#:52190-29-1 |
| Literature: Aziz, Jessy; Brachet, Etienne; Hamze, Abdallah; Peyrat, Jean-Francois; Bernadat, Guillaume; Morvan, Estelle; Bignon, Jerome; Wdzieczak-Bakala, Joanna; Desravines, Deborah; Dubois, Joelle; Tueni, Marie; Yassine, Ahmad; Brion, Jean-Daniel; Alami, Mouad Organic and Biomolecular Chemistry, 2013 , vol. 11, # 3 p. 430 - 442 |
|
~%
2-bromo-1-(3,4,... CAS#:52190-29-1 |
| Literature: Barata,L.E.S. et al. Phytochemistry (Elsevier), 1978 , vol. 17, p. 783 - 786 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Propiophenone,2-bromo-3',4',5'-trimethoxy |