1-(3,4,5-trimethoxyphenyl)propan-1-one
1-(3,4,5-trimethoxyphenyl)propan-1-one structure
|
Common Name | 1-(3,4,5-trimethoxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5658-50-4 | Molecular Weight | 224.25300 | |
| Density | 1.07g/cm3 | Boiling Point | 321.7ºC at 760 mmHg | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.7ºC | |
Summary: 1-(3,4,5-trimethoxyphenyl)propan-1-one, Chinese name 1-(3,4,5-三甲氧基苯基)丙酮, CAS number 5658-50-4, molecular formula C12H16O4, molecular weight 224.25300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,4,5-trimethoxyphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 321.7ºC at 760 mmHg |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25300 |
| Flash Point | 139.7ºC |
| Exact Mass | 224.10500 |
| PSA | 44.76000 |
| LogP | 2.30510 |
| Index of Refraction | 1.493 |
| InChIKey | FNFSOYGIQWSIEX-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cc(OC)c(OC)c(OC)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 3 | |
CAS#:29652-81-1
CAS#:758-96-3
CAS#:2675-79-8
CAS#:41564-88-9
CAS#:86-81-7
CAS#:1916-07-0
CAS#:118-41-2
CAS#:925-90-6
CAS#:4521-61-3
CAS#:25173-72-2
CAS#:41395-10-2
CAS#:52190-29-1This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propiophenone,3',4',5'-trimethoxy |
| 3',4',5'-trimethoxypropiophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: LogP of 1-(3,4,5-trimethoxyphenyl)propan-1-one is 2.30510. |
| Q: What is the Chinese name of 5658-50-4? |
| A: Chinese name of 5658-50-4 is 5658-50-4. |
| Q: What is the polar surface area (PSA) of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: Polar surface area (PSA) of 1-(3,4,5-trimethoxyphenyl)propan-1-one is 44.76000. |
| Q: What is the SMILES notation of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: SMILES notation of 1-(3,4,5-trimethoxyphenyl)propan-1-one is CCC(=O)c1cc(OC)c(OC)c(OC)c1. |
| Q: What is the molecular formula of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: Molecular formula of 1-(3,4,5-trimethoxyphenyl)propan-1-one is C12H16O4. |
| Q: What is the CAS number of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: CAS number of 1-(3,4,5-trimethoxyphenyl)propan-1-one is 5658-50-4. |
| Q: What are the downstream products of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: Related downstream products(CAS) of 1-(3,4,5-trimethoxyphenyl)propan-1-one: 25173-72-2;41395-10-2;52190-29-1. |
| Q: What is the molecular weight of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: Molecular weight of 1-(3,4,5-trimethoxyphenyl)propan-1-one is 224.25300. |
| Q: What are the upstream materials of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: Related upstream materials(CAS) of 1-(3,4,5-trimethoxyphenyl)propan-1-one: 29652-81-1;758-96-3;2675-79-8;41564-88-9;86-81-7;1916-07-0;118-41-2;925-90-6;4521-61-3. |
| Q: What is the InChIKey of 1-(3,4,5-trimethoxyphenyl)propan-1-one? |
| A: InChIKey of 1-(3,4,5-trimethoxyphenyl)propan-1-one is FNFSOYGIQWSIEX-UHFFFAOYSA-N. |