3,6-dimethoxy-2,4-bis(phenylmethoxy)benzaldehyde structure
|
Common Name | 3,6-dimethoxy-2,4-bis(phenylmethoxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 52249-84-0 | Molecular Weight | 378.41800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dimethoxy-2,4-bis(phenylmethoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H22O5 |
|---|---|
| Molecular Weight | 378.41800 |
| Exact Mass | 378.14700 |
| PSA | 53.99000 |
| LogP | 4.67430 |
| InChIKey | GCEAPVKVMYVTRI-UHFFFAOYSA-N |
| SMILES | COc1cc(OCc2ccccc2)c(OC)c(OCc2ccccc2)c1C=O |
|
~%
3,6-dimethoxy-2... CAS#:52249-84-0 |
| Literature: Iinuma; Tanaka; Ito; Mizuno Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 2 p. 660 - 667 |
|
~%
3,6-dimethoxy-2... CAS#:52249-84-0 |
| Literature: Iinuma; Matoba; Tanaka; Mizuno Chemical and Pharmaceutical Bulletin, 1986 , vol. 34, # 4 p. 1656 - 1662 |
| Benzaldehyde,3,6-dimethoxy-2,4-bis(phenylmethoxy) |