3,5-Diprenyl-4-hydroxybenzaldehyde structure
|
Common Name | 3,5-Diprenyl-4-hydroxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 52275-04-4 | Molecular Weight | 258.36 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 383.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C17H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.7±20.5 °C | |
Use of 3,5-Diprenyl-4-hydroxybenzaldehyde3, 5-diprenyl-4-hydroxybenzaldehyde is an isoprene phenyl butyl aldehyde. 3, 5-diprenyl-4-hydroxybenzaldehyde had the ability to inhibit biofilm formation in strains. 3, 5-diprenyl-4-hydroxybenzaldehyde can be used to study the potential synergistic effect of clinically relevant antibiotics [1]. |
| Name | 3,5-Diprenyl-4-hydroxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Description | 3, 5-diprenyl-4-hydroxybenzaldehyde is an isoprene phenyl butyl aldehyde. 3, 5-diprenyl-4-hydroxybenzaldehyde had the ability to inhibit biofilm formation in strains. 3, 5-diprenyl-4-hydroxybenzaldehyde can be used to study the potential synergistic effect of clinically relevant antibiotics [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.5±42.0 °C at 760 mmHg |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 |
| Flash Point | 163.7±20.5 °C |
| Exact Mass | 258.161987 |
| PSA | 37.30000 |
| LogP | 5.58 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | OHVUELCNFASQGY-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1cc(C=O)cc(CC=C(C)C)c1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2912499000 |
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 4-Hydroxy-3,5-bis(3-methyl-2-buten-1-yl)benzaldehyde |