4-nitro-N-octylbenzenesulfonamide structure
|
Common Name | 4-nitro-N-octylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 52374-21-7 | Molecular Weight | 314.40000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-N-octylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22N2O4S |
|---|---|
| Molecular Weight | 314.40000 |
| Exact Mass | 314.13000 |
| PSA | 100.37000 |
| LogP | 5.22850 |
| InChIKey | VXPCIZZIKFRVRQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
|
~88%
4-nitro-N-octyl... CAS#:52374-21-7 |
| Literature: Lukin, Oleg; Gramlich, Volker; Kandre, Ramchandra; Zhun, Igor; Felder, Thorsten; Schalley, Christoph A.; Dolgonos, Grigoriy Journal of the American Chemical Society, 2006 , vol. 128, # 27 p. 8964 - 8974 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-Nitro-N-octyl-benzenesulfonamide |
| [(4-nitrophenyl)sulfonyl]octylamine |