2-Amino-7,9-dimethyl-9H-purin-7-ium-6-olate structure
|
Common Name | 2-Amino-7,9-dimethyl-9H-purin-7-ium-6-olate | ||
|---|---|---|---|---|
| CAS Number | 524-35-6 | Molecular Weight | 179.179 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-7,9-dimethylpurin-9-ium-6-olate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H9N5O |
|---|---|
| Molecular Weight | 179.179 |
| Exact Mass | 179.080704 |
| PSA | 83.67000 |
| LogP | 0.10000 |
| InChIKey | NAIGKGQHPIGYBB-UHFFFAOYSA-N |
| SMILES | Cn1c[n+](C)c2nc(N)nc([O-])c21 |
| HS Code | 2933990090 |
|---|
|
~%
2-Amino-7,9-dim... CAS#:524-35-6 |
| Literature: THE UNIVERSITY OF AKRON Patent: WO2005/23760 A2, 2005 ; Location in patent: Page/Page column 32 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-amino-7,9-dimethylpurin-7-ium-6-olate |
| 9H-Purinium, 2-amino-6-hydroxy-7,9-dimethyl-, inner salt |
| 2-amino-7,9-dimethyl-6-purin-9-iumolate |
| 2-Amino-7,9-dimethyl-9H-purin-7-ium-6-olate |