medrylamine structure
|
Common Name | medrylamine | ||
|---|---|---|---|---|
| CAS Number | 524-99-2 | Molecular Weight | 285.38100 | |
| Density | 1.044g/cm3 | Boiling Point | 385.1ºC at 760mmHg | |
| Molecular Formula | C18H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.9ºC | |
| Name | 2-[(4-methoxyphenyl)-phenylmethoxy]-N,N-dimethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.044g/cm3 |
|---|---|
| Boiling Point | 385.1ºC at 760mmHg |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.38100 |
| Flash Point | 119.9ºC |
| Exact Mass | 285.17300 |
| PSA | 21.70000 |
| LogP | 3.36280 |
| Index of Refraction | 1.543 |
| InChIKey | BXCMCXBSUDRYPF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(OCCN(C)C)c2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
|
~%
medrylamine CAS#:524-99-2 |
| Literature: Union Chim. Belge Patent: US2668856 , 1948 ; |
|
~%
medrylamine CAS#:524-99-2 |
| Literature: Union Chim. Belge Patent: US2668856 , 1948 ; |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MEDRYLAMINE |
| Medrylaminum |
| Medrilamina [INN-Spanish] |
| Medrilamina |
| Medrylaminum [INN-Latin] |