2,5-Diaminoadipic acid dihydrochloride structure
|
Common Name | 2,5-Diaminoadipic acid dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 52408-04-5 | Molecular Weight | 249.092 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H14Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-Diaminoadipic acid dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H14Cl2N2O4 |
|---|---|
| Molecular Weight | 249.092 |
| Exact Mass | 248.033066 |
| PSA | 126.64000 |
| LogP | 1.59500 |
| InChIKey | OLQCFLWGFNLVME-UHFFFAOYSA-N |
| SMILES | Cl.Cl.NC(CCC(N)C(=O)O)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2,5-Diaminohexanedioic acid dihydrochloride |
| Hexanedioic acid, 2,5-diamino-, hydrochloride (1:2) |
| REF DUPL: 2,5-Diaminoadipic acid 2HCl |
| 2,4-DIAMINO-HEXANEDIOIC ACID DIHYDROCHLORIDE |
| 2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE |
| 2,5-Diamino-hexanedioic acid dihydrochloride |
| 2,5-Diaminoadipic acid 2HCl |