1-Methoxy-2,5-dimethyl-3-nitrobenzene structure
|
Common Name | 1-Methoxy-2,5-dimethyl-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 52415-07-3 | Molecular Weight | 181.189 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 288.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.2±27.9 °C | |
| Name | 1-Methoxy-2,5-dimethyl-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.7±35.0 °C at 760 mmHg |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.189 |
| Flash Point | 131.2±27.9 °C |
| Exact Mass | 181.073898 |
| PSA | 55.05000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | MNWRGXSPBQNIGR-UHFFFAOYSA-N |
| SMILES | COc1cc(C)cc([N+](=O)[O-])c1C |
| HS Code | 2909309090 |
|---|
|
~%
1-Methoxy-2,5-d... CAS#:52415-07-3 |
| Literature: Sonn Chemische Berichte, 1916 , vol. 49, p. 2591 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Methoxy-6-nitro-p-xylene |
| Benzene, 1-methoxy-2,5-dimethyl-3-nitro- |
| 1-Methoxy-2,5-dimethyl-3-nitrobenzene |