N,N-bis(4-chloro-2-nitro-phenyl)oxamide structure
|
Common Name | N,N-bis(4-chloro-2-nitro-phenyl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 52427-00-6 | Molecular Weight | 399.14300 | |
| Density | 1.727g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H8Cl2N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-bis(4-chloro-2-nitro-phenyl)oxamide |
|---|
| Density | 1.727g/cm3 |
|---|---|
| Molecular Formula | C14H8Cl2N4O6 |
| Molecular Weight | 399.14300 |
| Exact Mass | 397.98200 |
| PSA | 149.84000 |
| LogP | 4.57940 |
| Index of Refraction | 1.734 |
| InChIKey | XRWTZOOYPMQASF-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1[N+](=O)[O-])C(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N,N-bis(4-chlor... CAS#:52427-00-6 |
| Literature: Crowther et al. Journal of the Chemical Society, 1949 , p. 1260,1268 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |