methyl 2-(7-chloro-3,5-dioxo-1H-1,4-benzodiazepin-2-ylidene)acetate
Modify Date: 2025-10-10 03:03:56
methyl 2-(7-chloro-3,5-dioxo-1H-1,4-benzodiazepin-2-ylidene)acetate structure
|
Common Name | methyl 2-(7-chloro-3,5-dioxo-1H-1,4-benzodiazepin-2-ylidene)acetate | ||
|---|---|---|---|---|
| CAS Number | 5243-38-9 | Molecular Weight | 280.66400 | |
| Density | 1.491g/cm3 | Boiling Point | 498ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255ºC | |
| Name | methyl 2-(7-chloro-3,5-dioxo-1H-1,4-benzodiazepin-2-ylidene)acetate |
|---|
| Density | 1.491g/cm3 |
|---|---|
| Boiling Point | 498ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2O4 |
| Molecular Weight | 280.66400 |
| Flash Point | 255ºC |
| Exact Mass | 280.02500 |
| PSA | 92.28000 |
| LogP | 0.51670 |
| Index of Refraction | 1.637 |
| InChIKey | GPYLFWJNNWMQJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C=C1Nc2ccc(Cl)cc2C(=O)NC1=O |
| HS Code | 2917399090 |
|---|
|
~%
methyl 2-(7-chl... CAS#:5243-38-9 |
| Literature: Michel,K. et al. Helvetica Chimica Acta, 1965 , vol. 48, p. 1973 - 1983 |
|
~%
methyl 2-(7-chl... CAS#:5243-38-9 |
| Literature: Michel,K. et al. Helvetica Chimica Acta, 1965 , vol. 48, p. 1973 - 1983 |
|
~%
methyl 2-(7-chl... CAS#:5243-38-9 |
| Literature: Michel,K. et al. Helvetica Chimica Acta, 1965 , vol. 48, p. 1973 - 1983 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |