2,2,5,5-tetramethyl-1-phenylhexane-1-thione structure
|
Common Name | 2,2,5,5-tetramethyl-1-phenylhexane-1-thione | ||
|---|---|---|---|---|
| CAS Number | 52433-13-3 | Molecular Weight | 248.42700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,5,5-tetramethyl-1-phenylhexane-1-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H24S |
|---|---|
| Molecular Weight | 248.42700 |
| Exact Mass | 248.16000 |
| PSA | 32.09000 |
| LogP | 5.25710 |
| InChIKey | MMFIXSYYHJGKSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CCC(C)(C)C(=S)c1ccccc1 |
|
~%
2,2,5,5-tetrame... CAS#:52433-13-3 |
| Literature: Couture,A. et al. Journal of the American Chemical Society, 1976 , vol. 98, p. 6218 - 6225 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Hexanethione,2,2,5,5-tetramethyl-1-phenyl |