6-Bromotryptophan structure
|
Common Name | 6-Bromotryptophan | ||
|---|---|---|---|---|
| CAS Number | 52448-17-6 | Molecular Weight | 283.121 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 495.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7±28.7 °C | |
| Name | (2S)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.8±45.0 °C at 760 mmHg |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.121 |
| Flash Point | 253.7±28.7 °C |
| Exact Mass | 282.000397 |
| PSA | 79.11000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | OAORYCZPERQARS-VIFPVBQESA-N |
| SMILES | NC(Cc1c[nH]c2cc(Br)ccc12)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Tryptophan, 6-bromo- |
| 6-Bromo-L-tryptophan |
| (S)-2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic acid |
| 6-Bromotryptophan |
| L-Tryptophan, 6-bromo- |