Harmolol structure
|
Common Name | Harmolol | ||
|---|---|---|---|---|
| CAS Number | 525-57-5 | Molecular Weight | 200.23600 | |
| Density | 1.28g/cm3 | Boiling Point | 507.5ºC at 760mmHg | |
| Molecular Formula | C12H12N2O | Melting Point | 211-212ºC | |
| MSDS | N/A | Flash Point | 231ºC | |
| Name | harmalol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 507.5ºC at 760mmHg |
| Melting Point | 211-212ºC |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.23600 |
| Flash Point | 231ºC |
| Exact Mass | 200.09500 |
| PSA | 48.38000 |
| LogP | 1.67420 |
| Index of Refraction | 1.708 |
| InChIKey | RHVPEFQDYMMNSY-UHFFFAOYSA-N |
| SMILES | CC1=NCCc2c1[nH]c1cc(O)ccc21 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-27-36/37/39 |
| HS Code | 2933990090 |
|
~%
Harmolol CAS#:525-57-5 |
| Literature: Hasenfratz Annales de Chimie (Cachan, France), 1927 , vol. <10> 7, p. 183 |
|
~%
Harmolol CAS#:525-57-5 |
| Literature: Fischer,O.; Taeuber Chemische Berichte, 1885 , vol. 18, p. 402 Chemische Berichte, 1897 , vol. 30, p. 2482 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Harmolol |
| Harmidol |
| 3,4-dihydro-1-methyl-9H-pyrido[3,4-b]indol-7-ol |
| Einecs 208-375-4 |
| 11-Hydroxyharmalan |