2-acetamido-3-(4-acetyloxyphenyl)prop-2-enoic acid structure
|
Common Name | 2-acetamido-3-(4-acetyloxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 52507-18-3 | Molecular Weight | 263.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-acetamido-3-(4-acetyloxyphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO5 |
|---|---|
| Molecular Weight | 263.24600 |
| Exact Mass | 263.07900 |
| PSA | 96.19000 |
| LogP | 2.01380 |
| InChIKey | NLPVZVVUTYLLLA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=Cc1ccc(OC(C)=O)cc1)C(=O)O |
|
~%
2-acetamido-3-(... CAS#:52507-18-3 |
| Literature: Baker Journal of Biological Chemistry, 1951 , vol. 193, p. 809,815 |
|
~%
2-acetamido-3-(... CAS#:52507-18-3 |
| Literature: Baker Journal of Biological Chemistry, 1951 , vol. 193, p. 809,815 |
| 2-Propenoic acid,2-(acetylamino)-3-[4-(acetyloxy)phenyl] |