CHEMBRDG-BB 6873131
Modify Date: 2025-10-14 16:14:13
CHEMBRDG-BB 6873131 structure
|
Common Name | CHEMBRDG-BB 6873131 | ||
|---|---|---|---|---|
| CAS Number | 525570-78-9 | Molecular Weight | 282.65500 | |
| Density | 1.425g/cm3 | Boiling Point | 432.3ºC at 760 mmHg | |
| Molecular Formula | C12H8ClFN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.2ºC | |
| Name | 4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-methoxybenzaldehyde |
|---|
| Density | 1.425g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760 mmHg |
| Molecular Formula | C12H8ClFN2O3 |
| Molecular Weight | 282.65500 |
| Flash Point | 215.2ºC |
| Exact Mass | 282.02100 |
| PSA | 61.31000 |
| LogP | 2.88250 |
| Index of Refraction | 1.593 |
| InChIKey | OSUIGEZDSMVLJT-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)ccc1Oc1nc(Cl)ncc1F |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |