Octaphenylsilsesquioxane structure
|
Common Name | Octaphenylsilsesquioxane | ||
|---|---|---|---|---|
| CAS Number | 5256-79-1 | Molecular Weight | 1033.508 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 41.5ºC at 760mmHg | |
| Molecular Formula | C48H40O12Si8 | Melting Point | >350ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | Octaphenylsilsesquioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 41.5ºC at 760mmHg |
| Melting Point | >350ºC |
| Molecular Formula | C48H40O12Si8 |
| Molecular Weight | 1033.508 |
| Exact Mass | 1032.067383 |
| PSA | 110.76000 |
| LogP | 3.02240 |
| Index of Refraction | 1.659 |
| InChIKey | KBXJHRABGYYAFC-UHFFFAOYSA-N |
| SMILES | c1ccc([Si]23O[Si]4(c5ccccc5)O[Si]5(c6ccccc6)O[Si](c6ccccc6)(O2)O[Si]2(c6ccccc6)O[Si](c6ccccc6)(O3)O[Si](c3ccccc3)(O4)O[Si](c3ccccc3)(O5)O2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
Octaphenylsilse... CAS#:5256-79-1 |
| Literature: Moore, Brian M.; Ramirez, Sean M.; Yandek, Gregory R.; Haddad, Timothy S.; Mabry, Joseph M. Journal of Organometallic Chemistry, 2011 , vol. 696, # 13 p. 2676 - 2680 |
|
~76%
Octaphenylsilse... CAS#:5256-79-1 |
| Literature: Dare, Enock O.; Liu, Ling-Kang; Peng, James Dalton Transactions, 2006 , # 30 p. 3668 - 3671 |
|
~72%
Octaphenylsilse... CAS#:5256-79-1 |
| Literature: Kozelj, Matjaz; Orel, Boris Dalton Transactions, 2008 , # 37 p. 5072 - 5075 |
| Octaphenylsilsesquioxane |
| Hydrogen-POSS |
| octaphenyl-silsesquioxane |
| 1,3,5,7,9,11,13,15-Octaphenylpentacyclo[9.5.1.1.1.1]octasiloxane |
| 1,3,5,7,9,11,13,15-OCTAPHENYLPENTACYCLO-OCTASILOXANE |
| Pentacyclo[9.5.1.1.1.1]octasiloxane, 1,3,5,7,9,11,13,15-octaphenyl- |
| octaphenylpentacyclosilsesquioxane |
| pss-octaphenyl substituted |
| octaphenyloctasilsesquioxane |
| Poly(Phenyl Silsesquioxane) |
| Perphenyloctasilsesquioxane |
| phenyl8Si8O12 |
| Phenyl-POSS |
| Nitrophenyl-POSS |
| 1,3,5,7,9,11,13,15-Octaphenylpentacyclo[9.5.1.13,9.15,15.17,13]octasiloxane |
| MFCD00308870 |
| OCTAPHENYL-T8-SILSESQUIOXANE |
| Aminophenyl-POSS |