1H-Pyrido(3,4-b)indol-1-one, 2,3,4,9-tetrahydro-2-(2-(methyamino)benzoyl)- structure
|
Common Name | 1H-Pyrido(3,4-b)indol-1-one, 2,3,4,9-tetrahydro-2-(2-(methyamino)benzoyl)- | ||
|---|---|---|---|---|
| CAS Number | 526-43-2 | Molecular Weight | 319.35700 | |
| Density | 1.372g/cm3 | Boiling Point | 609.5ºC at 760 mmHg | |
| Molecular Formula | C19H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.4ºC | |
| Name | 2-[2-(methylamino)benzoyl]-4,9-dihydro-3H-pyrido[3,4-b]indol-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 609.5ºC at 760 mmHg |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.35700 |
| Flash Point | 322.4ºC |
| Exact Mass | 319.13200 |
| PSA | 65.20000 |
| LogP | 3.05920 |
| Index of Refraction | 1.737 |
| InChIKey | RAEOYMOPVHBBKE-UHFFFAOYSA-N |
| SMILES | CNc1ccccc1C(=O)N1CCc2c([nH]c3ccccc23)C1=O |
| HS Code | 2933990090 |
|---|
|
~%
1H-Pyrido(3,4-b... CAS#:526-43-2 |
| Literature: Pachter; Suld Journal of Organic Chemistry, 1960 , vol. 25, p. 1680 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[2-(methylamino)benzoyl]-2,3,4,9-tetrahydro-1h-|A-carbolin-1-one |