3-(2-Amino-ethyl)-5-methoxy-1H-indole-2-carboxylic acid
Modify Date: 2025-09-10 12:28:02
3-(2-Amino-ethyl)-5-methoxy-1H-indole-2-carboxylic acid structure
|
Common Name | 3-(2-Amino-ethyl)-5-methoxy-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 52648-13-2 | Molecular Weight | 234.25100 | |
| Density | 1.339g/cm3 | Boiling Point | 489.9ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 250.1ºC | |
| Name | 3-(2-Amino-ethyl)-5-methoxy-1H-indole-2-carboxylic acid |
|---|
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 489.9ºC at 760 mmHg |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25100 |
| Flash Point | 250.1ºC |
| Exact Mass | 234.10000 |
| PSA | 88.34000 |
| LogP | 2.07620 |
| Index of Refraction | 1.668 |
| InChIKey | FBEQOUNJJYSFJU-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(C(=O)O)c(CCN)c2c1 |
| HS Code | 2933990090 |
|---|
|
~99%
3-(2-Amino-ethy... CAS#:52648-13-2 |
| Literature: Guengoer, Timur; Malabre, Patrice; Teulon, Jean-Marie; Camborde, Francoise; Meignen, Joelle; et al. Journal of Medicinal Chemistry, 1994 , vol. 37, # 25 p. 4307 - 4316 |
![2,3,4,9-tetrahydro-6-methoxy-1H-pyrido[3,4-b]indol-1-one structure](https://image.chemsrc.com/caspic/406/17952-87-3.png)
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:608-07-1
CAS#:66-83-1| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |