dimethyl 3-acetamidobenzene-1,2-dicarboxylate structure
|
Common Name | dimethyl 3-acetamidobenzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 52659-18-4 | Molecular Weight | 251.23500 | |
| Density | 1.267g/cm3 | Boiling Point | 409.168ºC at 760 mmHg | |
| Molecular Formula | C12H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.258ºC | |
| Name | dimethyl 3-acetamidobenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 409.168ºC at 760 mmHg |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.23500 |
| Flash Point | 201.258ºC |
| Exact Mass | 251.07900 |
| PSA | 81.70000 |
| LogP | 1.29120 |
| Index of Refraction | 1.559 |
| InChIKey | BLCLLTBPXPJBFH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(NC(C)=O)c1C(=O)OC |
| HS Code | 2924299090 |
|---|
|
~82%
dimethyl 3-acet... CAS#:52659-18-4 |
| Literature: Usui, Taikou; Ban, Hyun Seung; Kawada, Junpei; Hirokawa, Takatsugu; Nakamura, Hiroyuki Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 1 p. 285 - 288 |
|
~%
dimethyl 3-acet... CAS#:52659-18-4 |
| Literature: Nugiel; Etzkorn; Vidwans; Benfield; Boisclair; Burton; Cox; Czerniak; Doleniak; Seitz Journal of Medicinal Chemistry, 2001 , vol. 44, # 9 p. 1334 - 1336 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl-3-N-acetylamino phthalate |