2-Chlorobenzhydryl amine structure
|
Common Name | 2-Chlorobenzhydryl amine | ||
|---|---|---|---|---|
| CAS Number | 5267-39-0 | Molecular Weight | 217.694 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 336.9±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H12ClN | Melting Point | 300-305 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 194.3±11.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-chlorophenyl)-phenylmethanamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 336.9±27.0 °C at 760 mmHg |
| Melting Point | 300-305 °C (dec.)(lit.) |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.694 |
| Flash Point | 194.3±11.8 °C |
| Exact Mass | 217.065826 |
| PSA | 26.02000 |
| LogP | 3.39 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | UHPRBUXOILBKFH-UHFFFAOYSA-N |
| SMILES | Cl.NC(c1ccccc1)c1ccc(Cl)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921499090 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 226-085-6 |
| (4-Chloropheny)phenylmethylamine |
| MFCD00044488 |
| (4-Chloropheny)phenylmethylamine Hydrochloride |
| 1-(4-Chlorophenyl)-1-phenylmethanamine hydrochloride (1:1) |
| (4-chlorophenyl)(phenyl)methylamine |
| (4-Chlorophenyl)(phenyl)methanamine |
| Benzenemethanamine, 4-chloro-α-phenyl-, hydrochloride (1:1) |
| 4-Chlorobenzhydrylamine hydrochloride |
| 1-(4-Chlorophenyl)-1-phenylmethanamine |
| p-chlorobenzhydrylamine hydrochloride |
| Benzenemethanamine, 4-chloro-α-phenyl- |