1,4,5,8-Naphthalenetetracarboxylic acid 1,8-monoanhydride
Modify Date: 2025-08-25 19:42:58
1,4,5,8-Naphthalenetetracarboxylic acid 1,8-monoanhydride structure
|
Common Name | 1,4,5,8-Naphthalenetetracarboxylic acid 1,8-monoanhydride | ||
|---|---|---|---|---|
| CAS Number | 52671-72-4 | Molecular Weight | 286.19300 | |
| Density | 1.769 | Boiling Point | 692.8ºC at 760 mmHg | |
| Molecular Formula | C14H6O7 | Melting Point | >300ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 1,4,5,8-Naphthalenetetracarboxylic acid 1,8-monoanhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.769 |
|---|---|
| Boiling Point | 692.8ºC at 760 mmHg |
| Melting Point | >300ºC |
| Molecular Formula | C14H6O7 |
| Molecular Weight | 286.19300 |
| Exact Mass | 286.01100 |
| PSA | 117.97000 |
| LogP | 1.54680 |
| Index of Refraction | 1.772 |
| InChIKey | YQXRNSHBINARCY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c3c(ccc(C(=O)O)c13)C(=O)OC2=O |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319-H400 |
| Precautionary Statements | P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | R36;R50 |
| Safety Phrases | S26-S36/37-S61 |
| RIDADR | UN 3077 |
| HS Code | 2932999099 |
|
~82%
1,4,5,8-Naphtha... CAS#:52671-72-4 |
| Literature: Barros; Cuccovia; Farah; Masini; Chaimovich; Politi Organic and Biomolecular Chemistry, 2006 , vol. 4, # 1 p. 71 - 82 |
|
~%
1,4,5,8-Naphtha... CAS#:52671-72-4 |
| Literature: Barros; Cuccovia; Farah; Masini; Chaimovich; Politi Organic and Biomolecular Chemistry, 2006 , vol. 4, # 1 p. 71 - 82 |
|
~%
1,4,5,8-Naphtha... CAS#:52671-72-4 |
| Literature: Barros; Cuccovia; Farah; Masini; Chaimovich; Politi Organic and Biomolecular Chemistry, 2006 , vol. 4, # 1 p. 71 - 82 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4,5,8-naphthalene diacid monoanhydride |
| 1,3-dioxo-1H,3H-benzo[de]isochromene-6,7-dicarboxylic acid |
| 1,4,5,8-naphthalene-tetracarboxylic acid monoanhydride |
| 1h,3h-naphtho[1,8-cd]pyran-6,7-dicarboxylic acid,1,3-dioxo |
| monoanhydride of 1,4,5,8-naphthalenetetracarboxylic acid |