4-Iodo-2-nitroanisole structure
|
Common Name | 4-Iodo-2-nitroanisole | ||
|---|---|---|---|---|
| CAS Number | 52692-09-8 | Molecular Weight | 279.03200 | |
| Density | 1.893g/cm3 | Boiling Point | 330.8ºC at 760mmHg | |
| Molecular Formula | C7H6INO3 | Melting Point | 96-98ºC | |
| MSDS | N/A | Flash Point | 153.9ºC | |
| Name | 4-Iodo-1-methoxy-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.893g/cm3 |
|---|---|
| Boiling Point | 330.8ºC at 760mmHg |
| Melting Point | 96-98ºC |
| Molecular Formula | C7H6INO3 |
| Molecular Weight | 279.03200 |
| Flash Point | 153.9ºC |
| Exact Mass | 278.93900 |
| PSA | 55.05000 |
| LogP | 2.73120 |
| Index of Refraction | 1.629 |
| InChIKey | WULXGCDMVLQZBT-UHFFFAOYSA-N |
| SMILES | COc1ccc(I)cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-iodo-1-methoxy-2-nitrobenzene |
| MFCD08060933 |
| 4-Iodo-2-nitroanisole |