2,2',3,4,5,5',6-Heptachlorobiphenyl structure
|
Common Name | 2,2',3,4,5,5',6-Heptachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 52712-05-7 | Molecular Weight | 395.32300 | |
| Density | 1.658 g/cm3 | Boiling Point | 408.3ºC at 760 mmHg | |
| Molecular Formula | C12H3Cl7 | Melting Point | 149°C | |
| MSDS | N/A | Flash Point | 199ºC | |
| Name | 2,2',3,4,5,5',6-Heptachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.658 g/cm3 |
|---|---|
| Boiling Point | 408.3ºC at 760 mmHg |
| Melting Point | 149°C |
| Molecular Formula | C12H3Cl7 |
| Molecular Weight | 395.32300 |
| Flash Point | 199ºC |
| Exact Mass | 391.80500 |
| LogP | 7.92740 |
| Index of Refraction | 1.632 |
| InChIKey | PYZHTHZEHQHHEN-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1 |
| HS Code | 2903999010 |
|---|
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
| 1,2,3,4,5-pentachloro-6-(2,5-dichlorophenyl)benzene |