2,2',3,4,4',5,6-Heptachlorobiphenyl
2,2',3,4,4',5,6-Heptachlorobiphenyl structure
|
Common Name | 2,2',3,4,4',5,6-Heptachlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 74472-47-2 | Molecular Weight | 395.32300 | |
| Density | 1.658g/cm3 | Boiling Point | 407.3ºC at 760 mmHg | |
| Molecular Formula | C12H3Cl7 | Melting Point | 131.31°C (estimate) | |
| MSDS | N/A | Flash Point | 198.3ºC | |
Summary: 2,2',3,4,4',5,6-Heptachlorobiphenyl, also known as Polychlorobiphenyl, with CAS number 74472-47-2, molecular formula C12H3Cl7, and molecular weight 395.32300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2',3,4,4',5,6-Heptachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.658g/cm3 |
|---|---|
| Boiling Point | 407.3ºC at 760 mmHg |
| Melting Point | 131.31°C (estimate) |
| Molecular Formula | C12H3Cl7 |
| Molecular Weight | 395.32300 |
| Flash Point | 198.3ºC |
| Exact Mass | 391.80500 |
| LogP | 7.92740 |
| Index of Refraction | 1.632 |
| InChIKey | DJEUXBQAKBLKPO-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,2',3,4,4',5,6... CAS#:74472-47-2 |
| Literature: Chemosphere, , vol. 31, # 2 p. 2687 - 2705 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2,3,4,5-pentachloro-6-(2,4-dichlorophenyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: Molecular weight of 2,2',3,4,4',5,6-Heptachlorobiphenyl is 395.32300. |
| Q: What is the LogP of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: LogP of 2,2',3,4,4',5,6-Heptachlorobiphenyl is 7.92740. |
| Q: What is the boiling point of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: Boiling point of 2,2',3,4,4',5,6-Heptachlorobiphenyl is 407.3ºC at 760 mmHg. |
| Q: What is the InChIKey of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: InChIKey of 2,2',3,4,4',5,6-Heptachlorobiphenyl is DJEUXBQAKBLKPO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: Molecular formula of 2,2',3,4,4',5,6-Heptachlorobiphenyl is C12H3Cl7. |
| Q: What English synonyms does 2,2',3,4,4',5,6-Heptachlorobiphenyl have? |
| A: English synonyms of 2,2',3,4,4',5,6-Heptachlorobiphenyl: 1,2,3,4,5-pentachloro-6-(2,4-dichlorophenyl)benzene. |
| Q: What is the CAS number of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: CAS number of 2,2',3,4,4',5,6-Heptachlorobiphenyl is 74472-47-2. |
| Q: What is the SMILES notation of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: SMILES notation of 2,2',3,4,4',5,6-Heptachlorobiphenyl is Clc1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1. |
| Q: What is the melting point of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: Melting point of 2,2',3,4,4',5,6-Heptachlorobiphenyl is 131.31°C (estimate). |
| Q: What is the English name of 2,2',3,4,4',5,6-Heptachlorobiphenyl? |
| A: The English name of 2,2',3,4,4',5,6-Heptachlorobiphenyl is 2,2',3,4,4',5,6-Heptachlorobiphenyl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |