4-Demethyl Daunomycinone
4-Demethyl Daunomycinone structure
|
Common Name | 4-Demethyl Daunomycinone | ||
|---|---|---|---|---|
| CAS Number | 52744-22-6 | Molecular Weight | 384.33600 | |
| Density | 1.709g/cm3 | Boiling Point | 656.1ºC at 760 mmHg | |
| Molecular Formula | C20H16O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 364.6ºC | |
Summary: 4-Demethyl Daunomycinone, Chinese name: 4-脱甲基柔红霉素, CAS number: 52744-22-6, molecular formula: C20H16O8, molecular weight: 384.33600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Demethyl Daunomycinone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.709g/cm3 |
|---|---|
| Boiling Point | 656.1ºC at 760 mmHg |
| Molecular Formula | C20H16O8 |
| Molecular Weight | 384.33600 |
| Flash Point | 364.6ºC |
| Exact Mass | 384.08500 |
| PSA | 152.36000 |
| LogP | 0.87850 |
| Index of Refraction | 1.769 |
| InChIKey | XYDJGVROLWFENK-YBTHPKLGSA-N |
| SMILES | CC(=O)C1(O)Cc2c(O)c3c(c(O)c2C(O)C1)C(=O)c1c(O)cccc1C3=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-demethyl-daunomicinone |
| 4-O-DeMethyldaunoMycinone |
| 4-DeMethoxy-4-hydroxydaunoMycinone |
| carminomycinone |
| (8S,10S)-8-Acetyl-7,8,9,10-tetrahydro-1,6,8,10,11-pentahydroxy-5,12-naphthacenedione |
| (+)-4-demethyldaunomycinone |
| cis-9-acetyl-4-hydroxy-7,8,9,10-tetrahydro-6,7,9,11-tetrahydroxy-5,12-naphthacenedione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Demethyl Daunomycinone? |
| A: The English name of 4-Demethyl Daunomycinone is 4-Demethyl Daunomycinone. |
| Q: What is the SMILES notation of 4-Demethyl Daunomycinone? |
| A: SMILES notation of 4-Demethyl Daunomycinone is CC(=O)C1(O)Cc2c(O)c3c(c(O)c2C(O)C1)C(=O)c1c(O)cccc1C3=O. |
| Q: What is the boiling point of 4-Demethyl Daunomycinone? |
| A: Boiling point of 4-Demethyl Daunomycinone is 656.1ºC at 760 mmHg. |
| Q: What are the upstream materials of 4-Demethyl Daunomycinone? |
| A: Related upstream materials(CAS) of 4-Demethyl Daunomycinone: 21794-55-8;20830-81-3;52794-97-5;144-62-7;23541-50-6. |
| Q: What is the LogP of 4-Demethyl Daunomycinone? |
| A: LogP of 4-Demethyl Daunomycinone is 0.87850. |
| Q: What is the polar surface area (PSA) of 4-Demethyl Daunomycinone? |
| A: Polar surface area (PSA) of 4-Demethyl Daunomycinone is 152.36000. |
| Q: What is the InChIKey of 4-Demethyl Daunomycinone? |
| A: InChIKey of 4-Demethyl Daunomycinone is XYDJGVROLWFENK-YBTHPKLGSA-N. |
| Q: What is the CAS number of 4-Demethyl Daunomycinone? |
| A: CAS number of 4-Demethyl Daunomycinone is 52744-22-6. |
| Q: What is the molecular weight of 4-Demethyl Daunomycinone? |
| A: Molecular weight of 4-Demethyl Daunomycinone is 384.33600. |
| Q: What English synonyms does 4-Demethyl Daunomycinone have? |
| A: English synonyms of 4-Demethyl Daunomycinone: 4-demethyl-daunomicinone, 4-O-DeMethyldaunoMycinone, 4-DeMethoxy-4-hydroxydaunoMycinone, carminomycinone, (8S,10S)-8-Acetyl-7,8,9,10-tetrahydro-1,6,8,10,11-pentahydroxy-5,12-naphthacenedione, (+)-4-demethyldaunomycinone, cis-9-acetyl-4-hydroxy-7,8,9,10-tetrahydro-6,7,9,11-tetrahydroxy-5,12-naphthacenedione. |