(4-nitrophenyl)methyl 3-methyl-2-phenylmethoxycarbonylamino-butanoate structure
|
Common Name | (4-nitrophenyl)methyl 3-methyl-2-phenylmethoxycarbonylamino-butanoate | ||
|---|---|---|---|---|
| CAS Number | 5276-76-6 | Molecular Weight | 386.39800 | |
| Density | 1.244g/cm3 | Boiling Point | 556.2ºC at 760 mmHg | |
| Molecular Formula | C20H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.2ºC | |
| Name | 4-nitrobenzyl ((benzyloxy)carbonyl)valinate |
|---|
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 556.2ºC at 760 mmHg |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.39800 |
| Flash Point | 290.2ºC |
| Exact Mass | 386.14800 |
| PSA | 110.45000 |
| LogP | 4.50310 |
| Index of Refraction | 1.569 |
| InChIKey | ALMXQZMYLWCKAM-UHFFFAOYSA-N |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
|
~%
(4-nitrophenyl)... CAS#:5276-76-6 |
| Literature: Tanaka, Fujie; Kinoshita, Keiko; Tanimura, Ryuji; Fujii, Ikuo Journal of the American Chemical Society, 1996 , vol. 118, # 10 p. 2332 - 2339 |
|
~%
(4-nitrophenyl)... CAS#:5276-76-6 |
| Literature: Stewart,F.H.C. Australian Journal of Chemistry, 1965 , vol. 18, p. 1095 - 1103 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |