N-methyl-N-(2-methyl-2-nitropropyl)aniline structure
|
Common Name | N-methyl-N-(2-methyl-2-nitropropyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 52768-03-3 | Molecular Weight | 208.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-N-(2-methyl-2-nitropropyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16N2O2 |
|---|---|
| Molecular Weight | 208.25700 |
| Exact Mass | 208.12100 |
| PSA | 49.06000 |
| LogP | 2.70130 |
| InChIKey | DKDWXTPONWTDTG-UHFFFAOYSA-N |
| SMILES | CN(CC(C)(C)[N+](=O)[O-])c1ccccc1 |
|
~%
N-methyl-N-(2-m... CAS#:52768-03-3 |
| Literature: Johnson Journal of the American Chemical Society, 1946 , vol. 68, p. 14,16 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzenamine,N-methyl-N-(2-methyl-2-nitropropyl) |