tris(2,6-dimethylphenyl) phosphite structure
|
Common Name | tris(2,6-dimethylphenyl) phosphite | ||
|---|---|---|---|---|
| CAS Number | 52830-49-6 | Molecular Weight | 394.44300 | |
| Density | N/A | Boiling Point | 456.3ºC at 760mmHg | |
| Molecular Formula | C24H27O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.1ºC | |
| Name | tris(2,6-dimethylphenyl) phosphite |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 456.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C24H27O3P |
| Molecular Weight | 394.44300 |
| Flash Point | 286.1ºC |
| Exact Mass | 394.17000 |
| PSA | 41.28000 |
| LogP | 7.30070 |
| InChIKey | YJLVKRVGSARISS-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1OP(Oc1c(C)cccc1C)Oc1c(C)cccc1C |
| HS Code | 2920901900 |
|---|
|
~71%
tris(2,6-dimeth... CAS#:52830-49-6 |
| Literature: Burton, Sarah D.; Kumara Swamy; Holmes, Joan M.; Day, Roberta O.; Holmes, Robert R. Journal of the American Chemical Society, 1990 , vol. 112, # 16 p. 6104 - 6115 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2920901900 |
|---|---|
| Summary | 2920901900 VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| phosphorous acid tris(2,6-dimethylphenyl) ester |
| Phenol,2,6-dimethyl-,phosphite (3:1) |