4-chloro-1-ethyl-1H-pyrazolo[3,4-b]pyridine-5-carbonyl chloride structure
|
Common Name | 4-chloro-1-ethyl-1H-pyrazolo[3,4-b]pyridine-5-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 52833-03-1 | Molecular Weight | 244.07700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-1-ethylpyrazolo[3,4-b]pyridine-5-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7Cl2N3O |
|---|---|
| Molecular Weight | 244.07700 |
| Exact Mass | 242.99700 |
| PSA | 47.78000 |
| LogP | 2.48360 |
| InChIKey | KQZOAQNTKVFCPP-UHFFFAOYSA-N |
| SMILES | CCn1ncc2c(Cl)c(C(=O)Cl)cnc21 |
| HS Code | 2933990090 |
|---|
|
~%
4-chloro-1-ethy... CAS#:52833-03-1 |
| Literature: GLAXO GROUP LIMITED Patent: WO2005/90353 A1, 2005 ; Location in patent: Page/Page column 82 ; WO 2005/090353 A1 |
|
~%
4-chloro-1-ethy... CAS#:52833-03-1 |
| Literature: E. R. Squibb and Sons, Inc. Patent: US3966746 A1, 1976 ; |
|
~43%
4-chloro-1-ethy... CAS#:52833-03-1 |
| Literature: Bristol-Myers Squibb Co. Patent: US6326379 B1, 2001 ; US 6326379 B1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-1-ethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylic acid chloride |
| 4-chloro-1-ethyl-1H-pyrazolo[3,4-b]pyridine-5-carbonyl chloride |
| 1H-Pyrazolo[3,4-b]pyridine-5-carbonyl chloride,4-chloro-1-ethyl |