3-(Dichloroacetyl)-2,2,5-trimethyloxazolidine
Modify Date: 2025-08-25 19:49:57
3-(Dichloroacetyl)-2,2,5-trimethyloxazolidine structure
|
Common Name | 3-(Dichloroacetyl)-2,2,5-trimethyloxazolidine | ||
|---|---|---|---|---|
| CAS Number | 52836-31-4 | Molecular Weight | 226.10000 | |
| Density | 1.231 g/cm3 | Boiling Point | 291.4ºC at 760 mmHg | |
| Molecular Formula | C8H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130ºC | |
| Name | 2,2-dichloro-1-(2,2,5-trimethyl-1,3-oxazolidin-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231 g/cm3 |
|---|---|
| Boiling Point | 291.4ºC at 760 mmHg |
| Molecular Formula | C8H13Cl2NO2 |
| Molecular Weight | 226.10000 |
| Flash Point | 130ºC |
| Exact Mass | 225.03200 |
| PSA | 29.54000 |
| LogP | 1.71140 |
| Index of Refraction | 1.477 |
| InChIKey | YNQSILKYZQZHFJ-UHFFFAOYSA-N |
| SMILES | CC1CN(C(=O)C(Cl)Cl)C(C)(C)O1 |
| HS Code | 2934999090 |
|---|
|
~%
3-(Dichloroacet... CAS#:52836-31-4 |
| Literature: Stauffer Chemical Company Patent: US3989503 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Binding affinity to SafBP receptor in Zea mays (maize) seedlings by [3H]Saf(R-29148) ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3081662
|
Total 1, Current Page 1 of 1
1
| 2,2,5-trimethyl-N-dichloroacetyl oxazolidine |
| 2-(dichloroacetyl)-2,2,5-trimethyl-oxazolidine |
| 2,2,5-trimethyl-3-(dichloroacetyl)-1,3-oxazolidine |
| EINECS 258-214-7 |
| OXAZOLIDINE,3-(DICHLOROACETYL)-2,2,5-TRIMETHYL |
| 2,2-Dichloro-1-(2,2,5-trimethyloxazolidin-3-yl)ethanone |
| 3-dichloroacetyl-2,2,5-trimethyl-oxazolidine |
| 3-(dichloroacetyl)-2,2,5-trimethyl-1,3-oxazolidine |