1,4-bis[(ethoxy-methyl-phosphoryl)oxy]butane structure
|
Common Name | 1,4-bis[(ethoxy-methyl-phosphoryl)oxy]butane | ||
|---|---|---|---|---|
| CAS Number | 5284-04-8 | Molecular Weight | 302.24100 | |
| Density | 1.13g/cm3 | Boiling Point | 394ºC at 760 mmHg | |
| Molecular Formula | C10H24O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.6ºC | |
| Name | 1,4-bis[[ethoxy(methyl)phosphoryl]oxy]butane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 394ºC at 760 mmHg |
| Molecular Formula | C10H24O6P2 |
| Molecular Weight | 302.24100 |
| Flash Point | 205.6ºC |
| Exact Mass | 302.10500 |
| PSA | 90.68000 |
| LogP | 3.51860 |
| Index of Refraction | 1.43 |
| InChIKey | SFOYPKLZVAEZAV-UHFFFAOYSA-N |
| SMILES | CCOP(C)(=O)OCCCCOP(C)(=O)OCC |
|
~%
1,4-bis[(ethoxy... CAS#:5284-04-8 |
| Literature: Struck Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 231 - 234 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| butane-1,4-diyl diethyl bis[methyl(phosphonate)] |