1,4-bis[[butyl(ethoxy)phosphoryl]oxy]butane structure
|
Common Name | 1,4-bis[[butyl(ethoxy)phosphoryl]oxy]butane | ||
|---|---|---|---|---|
| CAS Number | 5284-06-0 | Molecular Weight | 386.40100 | |
| Density | 1.054g/cm3 | Boiling Point | 472.9ºC at 760mmHg | |
| Molecular Formula | C16H36O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253ºC | |
| Name | 1,4-bis[[butyl(ethoxy)phosphoryl]oxy]butane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.054g/cm3 |
|---|---|
| Boiling Point | 472.9ºC at 760mmHg |
| Molecular Formula | C16H36O6P2 |
| Molecular Weight | 386.40100 |
| Flash Point | 253ºC |
| Exact Mass | 386.19900 |
| PSA | 90.68000 |
| LogP | 5.85920 |
| Index of Refraction | 1.441 |
| InChIKey | AGCWSTJSKCQZHB-UHFFFAOYSA-N |
| SMILES | CCCCP(=O)(OCC)OCCCCOP(=O)(CCCC)OCC |
|
~%
1,4-bis[[butyl(... CAS#:5284-06-0 |
| Literature: Struck Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 231 - 234 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| butane-1,4-diyl diethyl bis[butyl(phosphonate)] |