Benzene,1,4-bis(ethoxydimethylsilyl)-2,5-diethynyl structure
|
Common Name | Benzene,1,4-bis(ethoxydimethylsilyl)-2,5-diethynyl | ||
|---|---|---|---|---|
| CAS Number | 5284-05-9 | Molecular Weight | 330.29500 | |
| Density | 1.099g/cm3 | Boiling Point | 421.1ºC at 760mmHg | |
| Molecular Formula | C12H28O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.9ºC | |
| Name | Benzene,1,4-bis(ethoxydimethylsilyl)-2,5-diethynyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 421.1ºC at 760mmHg |
| Molecular Formula | C12H28O6P2 |
| Molecular Weight | 330.29500 |
| Flash Point | 221.9ºC |
| Exact Mass | 330.13600 |
| PSA | 90.68000 |
| LogP | 4.29880 |
| Index of Refraction | 1.623 |
| InChIKey | QHXHEDUSWYCAHZ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC)OCCCCOP(=O)(CC)OCC |
|
~%
Benzene,1,4-bis... CAS#:5284-05-9 |
| Literature: Struck Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 231 - 234 |
|
~%
Benzene,1,4-bis... CAS#:5284-05-9 |
| Literature: Pudovik,A. et al. J. Gen. Chem. USSR (Engl. Transl.), 1963 , vol. 33, # 1 p. 102 - 107,95 - 99 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-bis(ethoxydimethylsilyl)-2,5-diethynylbenzene |
| 1,4-Bis-(ethoxy-ethyl-phosphinyloxy)-butan |