3-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-oxazol-2-one structure
|
Common Name | 3-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-oxazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 52867-97-7 | Molecular Weight | 466.59100 | |
| Density | 1.16g/cm3 | Boiling Point | 579.9ºC at 760mmHg | |
| Molecular Formula | C27H35FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.5ºC | |
| Name | 3-[2-(diethylamino)ethyl]-4-(4-fluorophenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-oxazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 579.9ºC at 760mmHg |
| Molecular Formula | C27H35FN4O2 |
| Molecular Weight | 466.59100 |
| Flash Point | 304.5ºC |
| Exact Mass | 466.27400 |
| PSA | 44.86000 |
| LogP | 3.95680 |
| Index of Refraction | 1.57 |
| InChIKey | IQGZVIRZGHNHBK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCn1c(-c2ccc(F)cc2)c(CCN2CCN(c3ccccc3)CC2)oc1=O |
|
~%
3-[2-(diethylam... CAS#:52867-97-7 |
| Literature: Cascio, Giuseppe; Manghisi, Elso; Fregnan, Giancarlo Journal of Medicinal Chemistry, 1989 , vol. 32, # 10 p. 2241 - 2247 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(2-diethylaminoethyl)-4-(4-fluorophenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-oxazol-2-one |
| 3-(2-diethylamino-ethyl)-4-(4-fluoro-phenyl)-5-[2-(4-phenyl-piperazin-1-yl)-ethyl]-3H-oxazol-2-one |
| 2(3H)-Oxazolone,3-(2-(diethylamino)ethyl)-4-(4-fluorophenyl)-5-(2-(4-phenyl-1-piperazinyl)ethyl) |