4'-fluoro-2-hydroxy-4-(4-phenylpiperazin-1-yl)butyrophenone structure
|
Common Name | 4'-fluoro-2-hydroxy-4-(4-phenylpiperazin-1-yl)butyrophenone | ||
|---|---|---|---|---|
| CAS Number | 51037-47-9 | Molecular Weight | 342.40700 | |
| Density | 1.202g/cm3 | Boiling Point | 524.1ºC at 760mmHg | |
| Molecular Formula | C20H23FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.8ºC | |
| Name | 1-(4-fluorophenyl)-2-hydroxy-4-(4-phenylpiperazin-1-yl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 524.1ºC at 760mmHg |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.40700 |
| Flash Point | 270.8ºC |
| Exact Mass | 342.17400 |
| PSA | 43.78000 |
| LogP | 2.58450 |
| Index of Refraction | 1.582 |
| InChIKey | DTQPKKCVUDORIM-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)C(O)CCN1CCN(c2ccccc2)CC1 |
| HS Code | 2933599090 |
|---|
|
~%
4'-fluoro-2-hyd... CAS#:51037-47-9 |
| Literature: Cascio; Erba; Manghisi; Biazzi; Ferni; Fregnan Farmaco, Edizione Scientifica, 1980 , vol. 35, # 7 p. 605 - 614 |
|
~%
4'-fluoro-2-hyd... CAS#:51037-47-9 |
| Literature: Cascio; Erba; Manghisi; Biazzi; Ferni; Fregnan Farmaco, Edizione Scientifica, 1980 , vol. 35, # 7 p. 605 - 614 |
|
~%
4'-fluoro-2-hyd... CAS#:51037-47-9 |
| Literature: Cascio; Erba; Manghisi; Biazzi; Ferni; Fregnan Farmaco, Edizione Scientifica, 1980 , vol. 35, # 7 p. 605 - 614 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 256-929-9 |