n-Octanphosphonsure-bis-(2-Ethylhexyl)ester structure
|
Common Name | n-Octanphosphonsure-bis-(2-Ethylhexyl)ester | ||
|---|---|---|---|---|
| CAS Number | 52894-02-7 | Molecular Weight | 418.63400 | |
| Density | 0.905g/cm3 | Boiling Point | 482.6ºC at 760 mmHg | |
| Molecular Formula | C24H51O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.8ºC | |
| Name | Bis(2-ethylhexyl) octylphosphonate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.905g/cm3 |
|---|---|
| Boiling Point | 482.6ºC at 760 mmHg |
| Molecular Formula | C24H51O3P |
| Molecular Weight | 418.63400 |
| Flash Point | 258.8ºC |
| Exact Mass | 418.35800 |
| PSA | 45.34000 |
| LogP | 9.00600 |
| Index of Refraction | 1.446 |
| InChIKey | ALVKGSGIVCHADB-UHFFFAOYSA-N |
| SMILES | CCCCCCCCP(=O)(OCC(CC)CCCC)OCC(CC)CCCC |
|
~69%
n-Octanphosphon... CAS#:52894-02-7 |
| Literature: Cherkasov; Garifzyanov; Krasnova; Talan Russian Journal of General Chemistry, 2006 , vol. 76, # 10 p. 1537 - 1544 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| bis(2-ethylhexyl) 1-octylphosphonate |
| bis-(2-ethylhexyl)-octylphosphonate |
| octylphenylphosphonous acid |
| bis-(2-ethylhexyl)-(n-octyl)-phosphonate |
| Phosphine oxide,octylphenyl |
| octylphosphonic acid di-(2-ethylhexyl) ester |
| Octanphosphonsaeure-di-2-aethyl-hexylester |
| octylphenylphosphinous acid |
| Octyl(phenyl)phosphine oxide |