H-Pro-Leu-OH structure
|
Common Name | H-Pro-Leu-OH | ||
|---|---|---|---|---|
| CAS Number | 52899-07-7 | Molecular Weight | 228.28800 | |
| Density | 1.126g/cm3 | Boiling Point | 457.5ºC at 760 mmHg | |
| Molecular Formula | C11H20N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 230.5ºC | |
Use of H-Pro-Leu-OH(S)-4-Methyl-2-((S)-pyrrolidine-2-carboxamido)pentanoic acid is a leucine derivative[1]. |
| Name | 4-methyl-2-(pyrrolidine-2-carbonylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-4-Methyl-2-((S)-pyrrolidine-2-carboxamido)pentanoic acid is a leucine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 457.5ºC at 760 mmHg |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.28800 |
| Flash Point | 230.5ºC |
| Exact Mass | 228.14700 |
| PSA | 78.43000 |
| LogP | 1.07360 |
| Index of Refraction | 1.496 |
| InChIKey | ZKQOUHVVXABNDG-IUCAKERBSA-N |
| SMILES | CC(C)CC(NC(=O)C1CCCN1)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Differences in signalling by directly and indirectly binding ligands in bacterial chemotaxis.
EMBO J. 29 , 3484 - 3495, (2010) In chemotaxis of Escherichia coli and other bacteria, extracellular stimuli are perceived by transmembrane receptors that bind their ligands either directly, or indirectly through periplasmic-binding ... |
| L-prolyl-L-leucine |
| proline-leucine |
| D-prolyl-L-leucine |
| 4-methyl-2-(pyrrolidin-2-ylcarbonylamino)pentanoic acid |
| Pro-leu |
| L-Pro-L-Leu-OH |
| prolyl L-leucine |