H-Pro-Met-OH structure
|
Common Name | H-Pro-Met-OH | ||
|---|---|---|---|---|
| CAS Number | 52899-08-8 | Molecular Weight | 246.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Pro-Met-OHH-Pro-Met-OH is a dipeptide containing proline and methionine, which can serve as a substrate for prolinase. H-Pro-Met-OH can also be used for the synthesis of polypeptides[1][2]. |
| Name | (2S)-4-methylsulfanyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | H-Pro-Met-OH is a dipeptide containing proline and methionine, which can serve as a substrate for prolinase. H-Pro-Met-OH can also be used for the synthesis of polypeptides[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H18N2O3S |
|---|---|
| Molecular Weight | 246.33 |
| Exact Mass | 246.10400 |
| PSA | 103.73000 |
| LogP | 0.78060 |
| InChIKey | MTWJTFBVRDGROD-YUMQZZPRSA-N |
| SMILES | CSCCC(NC(=O)C1CCCN1)C(=O)O |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-Methionine,N-L-prolyl |
| L-Methionine,L-prolyl |
| L-Pro-L-Met |
| L-Prolyl-L-methionine |