4-(4-methoxybenzoyl)oxybenzoic acid structure
|
Common Name | 4-(4-methoxybenzoyl)oxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 52899-69-1 | Molecular Weight | 272.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methoxybenzoyl)oxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12O5 |
|---|---|
| Molecular Weight | 272.25300 |
| Exact Mass | 272.06800 |
| PSA | 72.83000 |
| LogP | 2.61260 |
| InChIKey | FDCMZOYSEHNDCP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~57%
4-(4-methoxyben... CAS#:52899-69-1 |
| Literature: Kalyvas; McIntyre Molecular crystals and liquid crystals, 1982 , vol. 80, # 1-4 p. 105 - 118 |
|
~%
4-(4-methoxyben... CAS#:52899-69-1 |
| Literature: Kalyvas; McIntyre Molecular crystals and liquid crystals, 1982 , vol. 80, # 1-4 p. 105 - 118 |
|
~%
4-(4-methoxyben... CAS#:52899-69-1 |
| Literature: Kalyvas; McIntyre Molecular crystals and liquid crystals, 1982 , vol. 80, # 1-4 p. 105 - 118 |
|
~%
4-(4-methoxyben... CAS#:52899-69-1 |
| Literature: Chen, Dongzhong; Wan, Lei; Fang, Jianglin; Yu, Xuehai Chemistry Letters, 2001 , # 11 p. 1156 - 1157 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-carboxyphenyl-4-methoxybenzoate |
| 4-Anisoyloxy-benzoesaeure |
| 4-(4-methoxy-benzoyloxy)-benzoic acid |
| Benzoic acid,4-methoxy-,4-carboxyphenyl ester |
| 4-(4-Methoxy-benzoyloxy)-benzoesaeure |