2-(1,3-diethoxy-1,3-dioxopropan-2-yl)benzoic acid structure
|
Common Name | 2-(1,3-diethoxy-1,3-dioxopropan-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 52962-28-4 | Molecular Weight | 280.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,3-diethoxy-1,3-dioxopropan-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O6 |
|---|---|
| Molecular Weight | 280.27300 |
| Exact Mass | 280.09500 |
| PSA | 89.90000 |
| LogP | 1.59460 |
| InChIKey | YGWJUHHTFAOCSU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccccc1C(=O)O |
|
~%
2-(1,3-diethoxy... CAS#:52962-28-4 |
| Literature: Hurtley Journal of the Chemical Society, 1929 , p. 1872 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-(Bis-aethoxycarbonyl-methyl)-benzoesaeure |
| Propanedioic acid,(2-carboxyphenyl)-,1,3-diethyl ester |
| (2-Carboxy-phenyl)-malonsaeure-diaethylester |
| Diethyl-o-carboxyphenylmalonat |
| 2-(bis-ethoxycarbonyl-methyl)-benzoic acid |