N-(4-fluorophenyl)-3-phenyl-propanamide structure
|
Common Name | N-(4-fluorophenyl)-3-phenyl-propanamide | ||
|---|---|---|---|---|
| CAS Number | 5298-86-2 | Molecular Weight | 243.27600 | |
| Density | 1.192g/cm3 | Boiling Point | 431.4ºC at 760 mmHg | |
| Molecular Formula | C15H14FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.7ºC | |
| Name | N-(4-fluorophenyl)-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 431.4ºC at 760 mmHg |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.27600 |
| Flash Point | 214.7ºC |
| Exact Mass | 243.10600 |
| PSA | 29.10000 |
| LogP | 3.47000 |
| Index of Refraction | 1.598 |
| InChIKey | OIWMUPBNVSEYPP-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-fluorophen... CAS#:5298-86-2 |
| Literature: Jung, Seunghee; Tsukuda, Yuki; Kawashima, Rie; Ishiki, Takumi; Matsumoto, Ayaka; Nakaniwa, Aya; Takagi, Miho; Noguchi, Takuya; Imai, Nobuyuki Tetrahedron Letters, 2013 , vol. 54, # 42 p. 5718 - 5720 |
|
~%
N-(4-fluorophen... CAS#:5298-86-2 |
| Literature: Jung, Seunghee; Tsukuda, Yuki; Kawashima, Rie; Ishiki, Takumi; Matsumoto, Ayaka; Nakaniwa, Aya; Takagi, Miho; Noguchi, Takuya; Imai, Nobuyuki Tetrahedron Letters, 2013 , vol. 54, # 42 p. 5718 - 5720 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Phenyl-propionsaeure-<4-fluor-anilid> |
| 4'-fluoro-hydrocinnamanilide |
| N-(4-FLUOROPHENYL)-3-PHENYL-PROPANAMIDE |
| Propanamide,N-(4-fluorophenyl)-3-phenyl |