Nicotinamide adenine dinucleotide phosphate structure
|
Common Name | Nicotinamide adenine dinucleotide phosphate | ||
|---|---|---|---|---|
| CAS Number | 53-59-8 | Molecular Weight | 744.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H29N7O17P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nicotinamide adenine dinucleotide phosphateNADP is nicotinamide adenine dinucleotide phosphate, acting as a key cofactor for electron transfer in the metabolism of all organisms, being alternately oxidized (NADP+) and reduced (NADPH). |
| Name | NADP zwitterion |
|---|---|
| Synonym | More Synonyms |
| Description | NADP is nicotinamide adenine dinucleotide phosphate, acting as a key cofactor for electron transfer in the metabolism of all organisms, being alternately oxidized (NADP+) and reduced (NADPH). |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Molecular Formula | C21H29N7O17P3 |
|---|---|
| Molecular Weight | 744.41 |
| PSA | 397.05000 |
| LogP | -7.30 |
| InChIKey | ZKJOXOJMGXFSPF-QYZPTAICSA-N |
| SMILES | NC(=O)c1ccc[n+](C2OC(COP(=O)([O-])OP(=O)(O)OCC3OC(n4cnc5c(N)ncnc54)C(OP(=O)(O)O)C3O)C(O)C2O)c1.O |
| Storage condition | −20°C |
| Water Solubility | H2O: 50 mg/mL, clear, slightly yellow |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| RTECS | UU3440000 |
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Dissociation rate constant of compound for wild type Escherichia coli dihydrofolate r...
Source: ChEMBL
Target: Dihydrofolate reductase
External Id: CHEMBL668112
|
|
Name: Dissociation constant towards DHFR mutant F31W
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL696565
|
|
Name: Dissociation constant towards human DHFR mutant hF31S
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL699207
|
|
Name: Ratio of Kcat to Km for Listeria monocytogenes HMGR class II using NADPH substrate
Source: ChEMBL
Target: N/A
External Id: CHEMBL1819635
|
|
Name: Ratio of Kcat to Km for Streptococcus pneumoniae HMGR class II using NADPH substrate
Source: ChEMBL
Target: N/A
External Id: CHEMBL1819634
|
|
Name: Dissociation constant towards human wild type DHFR
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL697609
|
|
Name: Antiviral activity determined as inhibition of SARS-CoV-2 induced cytotoxicity of VER...
Source: ChEMBL
Target: Severe acute respiratory syndrome coronavirus 2
External Id: CHEMBL4513082
|
|
Name: Inhibition of sodium fluorescein uptake in OATP1B3-transfected CHO cells at an equimo...
Source: ChEMBL
Target: Solute carrier organic anion transporter family member 1B3
External Id: CHEMBL3039491
|
|
Name: SARS-CoV-2 3CL-Pro protease inhibition percentage at 20µM by FRET kind of response f...
Source: ChEMBL
Target: Replicase polyprotein 1ab
External Id: CHEMBL4495582
|
|
Name: Dissociation constant towards mouse DHFR mutant hF31S
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL734994
|
| NADPH |
| NADP-ox |
| NADP+ |
| COENZYME II |
| b-Nicotinamide Adenine Dinucleotide Phosphate |
| cozymaseii |
| β-Nicotinamide Adenine Dinucleotide Phosphate |
| TPNH |
| b-NADP |
| β-Triphosphopyridine Nucleotide |
| TPN |
| Triphosphopyridinnucleotid |
| 3-Carbamoyl-1-b-D-ribofuranosylpyridinium Hydroxide 5'®5'-Ester with Adenosine 2'-(Dihydrogen Phosphate) 5'-(Trihydrogen Pyrophosphate) Inner Salt |
| Co II |
| Adenosine 5'-(Trihydrogen Diphosphate) 2'-(Dihydrogen Phosphate) P'®5'-Ester with 3-(Aminocarbonyl)-1-b-D-ribofuranosylpyridinium Hydroxide Inner Salt |
| Beta-NADP,Monopotassium Salt |
| MFCD10567218 |
| NADP |
| b-TPN |
| β-Nicotinamide adenine dinucleotide phosphate (NADP) |
| Triphosphopyridine Nucleotid |
| Triphosphopyridine nucleotide |