6-Thioinosine Phosphate structure
|
Common Name | 6-Thioinosine Phosphate | ||
|---|---|---|---|---|
| CAS Number | 53-83-8 | Molecular Weight | 364.27 | |
| Density | 2.25g/cm3 | Boiling Point | 833.4ºC at 760mmHg | |
| Molecular Formula | C10H13N4O7PS | Melting Point | 149-155ºC (dec.) | |
| MSDS | N/A | Flash Point | 457.9ºC | |
Use of 6-Thioinosine Phosphate6-Thioinosine Phosphate (Thioinosinic acid) is an intermediate metabolite of azathioprine (HY-B0256). Azathioprine is a purine analog immunosuppressive drug[1]. |
| Name | 6-Thioinosine Phosphate |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Thioinosine Phosphate (Thioinosinic acid) is an intermediate metabolite of azathioprine (HY-B0256). Azathioprine is a purine analog immunosuppressive drug[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.25g/cm3 |
|---|---|
| Boiling Point | 833.4ºC at 760mmHg |
| Melting Point | 149-155ºC (dec.) |
| Molecular Formula | C10H13N4O7PS |
| Molecular Weight | 364.27 |
| Flash Point | 457.9ºC |
| Exact Mass | 364.02400 |
| PSA | 208.66000 |
| Index of Refraction | 1.903 |
| InChIKey | ZKRFOXLVOKTUTA-KQYNXXCUSA-N |
| SMILES | O=P(O)(O)OCC1OC(n2cnc3c(=S)nc[nH]c32)C(O)C1O |
| thioinosinic acid |
| 6-Thio-IMP |
| 6-thioinosine 5'-monophosphate |
| 6-Thio-5'-inosinic Acid |
| 6-Thioinosinic Acid |
| 6-Thio |
| 6-Mercaptopurine Ribonucleotide |
| 6-Thioinosine 5'-Phosphate |