2-(1,1,2,3,3,3-hexafluoropropyl)oxolane structure
|
Common Name | 2-(1,1,2,3,3,3-hexafluoropropyl)oxolane | ||
|---|---|---|---|---|
| CAS Number | 53005-42-8 | Molecular Weight | 222.12800 | |
| Density | 1.366g/cm3 | Boiling Point | 135-137ºC | |
| Molecular Formula | C7H8F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 42.9ºC | |
| Name | 2-(1,1,2,3,3,3-hexafluoropropyl)oxolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 135-137ºC |
| Molecular Formula | C7H8F6O |
| Molecular Weight | 222.12800 |
| Flash Point | 42.9ºC |
| Exact Mass | 222.04800 |
| PSA | 9.23000 |
| LogP | 2.70110 |
| Index of Refraction | 1.344 |
| InChIKey | LUFBQXOWLQEASN-UHFFFAOYSA-N |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCCO1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(1,1,2,3,3,3-Hexafluoropropyl)tetrahydrofuran |
| 2-(1,1,2,3,3,3-Hexafluoroprop-1-yl)oxolane |
| 2H-1-(2-tetrahydrofuryl)-pentafluoropropane |
| 2-<2-Hydroperfluorpropyl>-tetrahydrofuran |
| 2,6-BIS-(2-METHYL-ALLYL)-1,2,3,6-TETRAHYDRO-PYRIDINE |
| 2-(2H-hexafluoropropyl)oxolane |
| 2-(2H-hexafluoro-propyl)-tetrahydro-furan |
| PC9224 |