n-(5-bromo-2-fluorobenzyl)phthalimide structure
|
Common Name | n-(5-bromo-2-fluorobenzyl)phthalimide | ||
|---|---|---|---|---|
| CAS Number | 530141-44-7 | Molecular Weight | 334.14000 | |
| Density | 1.66 g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C15H9BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | n-(5-bromo-2-fluorobenzyl)phthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66 g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C15H9BrFNO2 |
| Molecular Weight | 334.14000 |
| Flash Point | 220.9ºC |
| Exact Mass | 332.98000 |
| PSA | 37.38000 |
| LogP | 3.32230 |
| Index of Refraction | 1.662 |
| InChIKey | BNQNVOUVZHMFCA-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(Br)ccc1F |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2925190090 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-bromo-2-fluorobenzylphthalimide |