2,6-dimethyl-3-ethylbenzothiazolium iodide structure
|
Common Name | 2,6-dimethyl-3-ethylbenzothiazolium iodide | ||
|---|---|---|---|---|
| CAS Number | 5304-18-7 | Molecular Weight | 319.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14INS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethyl-3-ethylbenzothiazolium iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14INS |
|---|---|
| Molecular Weight | 319.20500 |
| Exact Mass | 318.98900 |
| PSA | 32.12000 |
| Index of Refraction | 1.697 |
| InChIKey | LKTNFBVQAYVDIX-UHFFFAOYSA-M |
| SMILES | CC[n+]1c(C)sc2cc(C)ccc21.[I-] |
| HS Code | 2934999090 |
|---|
|
~%
2,6-dimethyl-3-... CAS#:5304-18-7 |
| Literature: Mills Journal of the Chemical Society, 1922 , vol. 121, p. 464 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Aethyl-2,6-dimethyl-benzothiazolium,Jodid |
| 3-ethyl-2,6-dimethyl-benzothiazolium,iodide |
| Benzothiazolium,3-ethyl-2,6-dimethyl-,iodide (1:1) |
| Benzothiazolium,3-ethyl-2,6-dimethyl-,iodide |
| 2,6-Dimethyl-3-ethyl-benzthiazolium |